C12H14BrF2NO — CID 102731340
trans-(1R,2R)-2-(4-bromo-2,6-difluoroanilino)cyclohexan-1-ol (PubChem CID 102731340) has the molecular formula C12H14BrF2NO and a molecular weight of 306.15 g/mol. Its IUPAC name is trans-(1R,2R)-2-(4-bromo-2,6-difluoroanilino)cyclohexan-1-ol.
| Compound Name | trans-(1R,2R)-2-(4-bromo-2,6-difluoroanilino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 102731340 |
| Molecular Formula | C12H14BrF2NO |
| Molecular Weight | 306.15 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | trans-(1R,2R)-2-(4-bromo-2,6-difluoroanilino)cyclohexan-1-ol |
| SMILES | O[C@@H]1CCCC[C@H]1Nc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C12H14BrF2NO/c13-7-5-8(14)12(9(15)6-7)16-10-3-1-2-4-11(10)17/h5-6,10-11,16-17H,1-4H2/t10-,11-/m1/s1 |
| InChIKey | FYXKDKATGHMADS-GHMZBOCLSA-N |
| XLogP | 3.44 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.15 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |