C15H20ClF2N — CID 83081176
2-chloro-4,6-difluoro-N-(2-propan-2-ylcyclohexyl)aniline (PubChem CID 83081176) has the molecular formula C15H20ClF2N and a molecular weight of 287.78 g/mol. Its IUPAC name is 2-chloro-4,6-difluoro-N-(2-propan-2-ylcyclohexyl)aniline.
| Compound Name | 2-chloro-4,6-difluoro-N-(2-propan-2-ylcyclohexyl)aniline |
|---|---|
| PubChem CID | 83081176 |
| Molecular Formula | C15H20ClF2N |
| Molecular Weight | 287.78 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 2-chloro-4,6-difluoro-N-(2-propan-2-ylcyclohexyl)aniline |
| SMILES | CC(C)C1CCCCC1Nc1c(F)cc(F)cc1Cl |
| InChI | InChI=1S/C15H20ClF2N/c1-9(2)11-5-3-4-6-14(11)19-15-12(16)7-10(17)8-13(15)18/h7-9,11,14,19H,3-6H2,1-2H3 |
| InChIKey | ZRZSZIOYKFKFRB-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.78 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |