C14H18ClF2NO — CID 83081632
N-(2-chloro-4,6-difluorophenyl)-2-propan-2-yloxan-4-amine (PubChem CID 83081632) has the molecular formula C14H18ClF2NO and a molecular weight of 289.75 g/mol. Its IUPAC name is N-(2-chloro-4,6-difluorophenyl)-2-propan-2-yloxan-4-amine.
| Compound Name | N-(2-chloro-4,6-difluorophenyl)-2-propan-2-yloxan-4-amine |
|---|---|
| PubChem CID | 83081632 |
| Molecular Formula | C14H18ClF2NO |
| Molecular Weight | 289.75 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | N-(2-chloro-4,6-difluorophenyl)-2-propan-2-yloxan-4-amine |
| SMILES | CC(C)C1CC(Nc2c(F)cc(F)cc2Cl)CCO1 |
| InChI | InChI=1S/C14H18ClF2NO/c1-8(2)13-7-10(3-4-19-13)18-14-11(15)5-9(16)6-12(14)17/h5-6,8,10,13,18H,3-4,7H2,1-2H3 |
| InChIKey | VEMNFIQNKIQLQI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.75 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |