C11H17NO3 — CID 71236321
N-ethyl-2,3,6-trimethoxyaniline (PubChem CID 71236321) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is N-ethyl-2,3,6-trimethoxyaniline.
| Compound Name | N-ethyl-2,3,6-trimethoxyaniline |
|---|---|
| PubChem CID | 71236321 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | N-ethyl-2,3,6-trimethoxyaniline |
| SMILES | CCNc1c(OC)ccc(OC)c1OC |
| InChI | InChI=1S/C11H17NO3/c1-5-12-10-8(13-2)6-7-9(14-3)11(10)15-4/h6-7,12H,5H2,1-4H3 |
| InChIKey | GEKVTTBCKXESLT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |