About 1-N,2-N-diethylbenzene-1,2-diamine;hydrochloride
1-N,2-N-diethylbenzene-1,2-diamine;hydrochloride (PubChem CID 158225673) has the molecular formula C10H17ClN2
and a molecular weight of 200.71 g/mol. Its IUPAC name is 1-N,2-N-diethylbenzene-1,2-diamine;hydrochloride.
Molecular Properties
| Compound Name | 1-N,2-N-diethylbenzene-1,2-diamine;hydrochloride |
| PubChem CID | 158225673 |
| Molecular Formula | C10H17ClN2 |
| Molecular Weight | 200.71 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 1-N,2-N-diethylbenzene-1,2-diamine;hydrochloride |
| SMILES | CCNc1ccccc1NCC.Cl |
| InChI | InChI=1S/C10H16N2.ClH/c1-3-11-9-7-5-6-8-10(9)12-4-2;/h5-8,11-12H,3-4H2,1-2H3;1H |
| InChIKey | GDTQTRWCVSEOEV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.71 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'} |
|---|
Analyze 1-N,2-N-diethylbenzene-1,2-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,2-N-diethylbenzene-1,2-diamine;hydrochloride?
The IUPAC name of 1-N,2-N-diethylbenzene-1,2-diamine;hydrochloride (CID 158225673) is 1-N,2-N-diethylbenzene-1,2-diamine;hydrochloride.
What is the SMILES notation for 1-N,2-N-diethylbenzene-1,2-diamine;hydrochloride?
The canonical SMILES for 1-N,2-N-diethylbenzene-1,2-diamine;hydrochloride is CCNc1ccccc1NCC.Cl.
What is the InChIKey of 1-N,2-N-diethylbenzene-1,2-diamine;hydrochloride?
The InChIKey is GDTQTRWCVSEOEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2.ClH/c1-3-11-9-7-5-6-8-10(9)12-4-2;/h5-8,11-12H,3-4H2,1-2H3;1H.
What are the key properties of 1-N,2-N-diethylbenzene-1,2-diamine;hydrochloride?
1-N,2-N-diethylbenzene-1,2-diamine;hydrochloride has a molecular weight of 200.71 g/mol, XLogP of 2.97, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,2-N-diethylbenzene-1,2-diamine;hydrochloride is sourced from PubChem (CID 158225673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).