C10H17ClN2 — CID 158225673
1-N,2-N-diethylbenzene-1,2-diamine;hydrochloride (PubChem CID 158225673) has the molecular formula C10H17ClN2 and a molecular weight of 200.71 g/mol. Its IUPAC name is 1-N,2-N-diethylbenzene-1,2-diamine;hydrochloride.
| Compound Name | 1-N,2-N-diethylbenzene-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 158225673 |
| Molecular Formula | C10H17ClN2 |
| Molecular Weight | 200.71 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 1-N,2-N-diethylbenzene-1,2-diamine;hydrochloride |
| SMILES | CCNc1ccccc1NCC.Cl |
| InChI | InChI=1S/C10H16N2.ClH/c1-3-11-9-7-5-6-8-10(9)12-4-2;/h5-8,11-12H,3-4H2,1-2H3;1H |
| InChIKey | GDTQTRWCVSEOEV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.71 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'} |
|---|