C18H18N2 — CID 21321128
1-N-ethyl-2-N-naphthalen-2-ylbenzene-1,2-diamine (PubChem CID 21321128) has the molecular formula C18H18N2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 1-N-ethyl-2-N-naphthalen-2-ylbenzene-1,2-diamine.
| Compound Name | 1-N-ethyl-2-N-naphthalen-2-ylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 21321128 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 1-N-ethyl-2-N-naphthalen-2-ylbenzene-1,2-diamine |
| SMILES | CCNc1ccccc1Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H18N2/c1-2-19-17-9-5-6-10-18(17)20-16-12-11-14-7-3-4-8-15(14)13-16/h3-13,19-20H,2H2,1H3 |
| InChIKey | ZFUOMQSDBJVMKB-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |