About nonane;N-phenylnaphthalen-2-amine
nonane;N-phenylnaphthalen-2-amine (PubChem CID 159912384) has the molecular formula C25H33N
and a molecular weight of 347.55 g/mol. Its IUPAC name is nonane;N-phenylnaphthalen-2-amine.
Molecular Properties
| Compound Name | nonane;N-phenylnaphthalen-2-amine |
| PubChem CID | 159912384 |
| Molecular Formula | C25H33N |
| Molecular Weight | 347.55 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | nonane;N-phenylnaphthalen-2-amine |
| SMILES | CCCCCCCCC.c1ccc(Nc2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C16H13N.C9H20/c1-2-8-15(9-3-1)17-16-11-10-13-6-4-5-7-14(13)12-16;1-3-5-7-9-8-6-4-2/h1-12,17H;3-9H2,1-2H3 |
| InChIKey | NXIPTJVHGVQREV-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.55 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze nonane;N-phenylnaphthalen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonane;N-phenylnaphthalen-2-amine?
The IUPAC name of nonane;N-phenylnaphthalen-2-amine (CID 159912384) is nonane;N-phenylnaphthalen-2-amine.
What is the SMILES notation for nonane;N-phenylnaphthalen-2-amine?
The canonical SMILES for nonane;N-phenylnaphthalen-2-amine is CCCCCCCCC.c1ccc(Nc2ccc3ccccc3c2)cc1.
What is the InChIKey of nonane;N-phenylnaphthalen-2-amine?
The InChIKey is NXIPTJVHGVQREV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N.C9H20/c1-2-8-15(9-3-1)17-16-11-10-13-6-4-5-7-14(13)12-16;1-3-5-7-9-8-6-4-2/h1-12,17H;3-9H2,1-2H3.
What are the key properties of nonane;N-phenylnaphthalen-2-amine?
nonane;N-phenylnaphthalen-2-amine has a molecular weight of 347.55 g/mol, XLogP of 8.34, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for nonane;N-phenylnaphthalen-2-amine is sourced from PubChem (CID 159912384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).