About octan-1-amine;N-phenylaniline
octan-1-amine;N-phenylaniline (PubChem CID 68728866) has the molecular formula C20H30N2
and a molecular weight of 298.47 g/mol. Its IUPAC name is octan-1-amine;N-phenylaniline.
Molecular Properties
| Compound Name | octan-1-amine;N-phenylaniline |
| PubChem CID | 68728866 |
| Molecular Formula | C20H30N2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | octan-1-amine;N-phenylaniline |
| SMILES | CCCCCCCCN.c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11N.C8H19N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-3-4-5-6-7-8-9/h1-10,13H;2-9H2,1H3 |
| InChIKey | SNYRJZZJUXWFIB-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octan-1-amine;N-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octan-1-amine;N-phenylaniline?
The IUPAC name of octan-1-amine;N-phenylaniline (CID 68728866) is octan-1-amine;N-phenylaniline.
What is the SMILES notation for octan-1-amine;N-phenylaniline?
The canonical SMILES for octan-1-amine;N-phenylaniline is CCCCCCCCN.c1ccc(Nc2ccccc2)cc1.
What is the InChIKey of octan-1-amine;N-phenylaniline?
The InChIKey is SNYRJZZJUXWFIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N.C8H19N/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-2-3-4-5-6-7-8-9/h1-10,13H;2-9H2,1H3.
What are the key properties of octan-1-amine;N-phenylaniline?
octan-1-amine;N-phenylaniline has a molecular weight of 298.47 g/mol, XLogP of 5.74, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for octan-1-amine;N-phenylaniline is sourced from PubChem (CID 68728866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).