C14H22N2 — CID 174672832
2-[(Z)-but-2-en-2-yl]-1-N,3-N-diethylbenzene-1,3-diamine (PubChem CID 174672832) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 2-[(Z)-but-2-en-2-yl]-1-N,3-N-diethylbenzene-1,3-diamine.
| Compound Name | 2-[(Z)-but-2-en-2-yl]-1-N,3-N-diethylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 174672832 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 2-[(Z)-but-2-en-2-yl]-1-N,3-N-diethylbenzene-1,3-diamine |
| SMILES | C/C=C(/C)c1c(NCC)cccc1NCC |
| InChI | InChI=1S/C14H22N2/c1-5-11(4)14-12(15-6-2)9-8-10-13(14)16-7-3/h5,8-10,15-16H,6-7H2,1-4H3/b11-5- |
| InChIKey | ABQPYYLLRVBFKD-WZUFQYTHSA-N |
| XLogP | 3.97 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |