C16H28 — CID 144812182
2-[(Z)-but-2-en-2-yl]-1,3-dimethylbenzene;ethane (PubChem CID 144812182) has the molecular formula C16H28 and a molecular weight of 220.40 g/mol. Its IUPAC name is 2-[(Z)-but-2-en-2-yl]-1,3-dimethylbenzene;ethane.
| Compound Name | 2-[(Z)-but-2-en-2-yl]-1,3-dimethylbenzene;ethane |
|---|---|
| PubChem CID | 144812182 |
| Molecular Formula | C16H28 |
| Molecular Weight | 220.40 g/mol |
| Exact Mass | 220.22 |
| IUPAC Name | 2-[(Z)-but-2-en-2-yl]-1,3-dimethylbenzene;ethane |
| SMILES | C/C=C(/C)c1c(C)cccc1C.CC.CC |
| InChI | InChI=1S/C12H16.2C2H6/c1-5-9(2)12-10(3)7-6-8-11(12)4;2*1-2/h5-8H,1-4H3;2*1-2H3/b9-5-;; |
| InChIKey | QLEDSKGYRUIPQT-XDYVNXDCSA-N |
| XLogP | 5.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.40 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |