C14H18 — CID 174000600
1,3-dimethyl-2-(4-methylpenta-1,3-dien-2-yl)benzene (PubChem CID 174000600) has the molecular formula C14H18 and a molecular weight of 186.30 g/mol. Its IUPAC name is 1,3-dimethyl-2-(4-methylpenta-1,3-dien-2-yl)benzene.
| Compound Name | 1,3-dimethyl-2-(4-methylpenta-1,3-dien-2-yl)benzene |
|---|---|
| PubChem CID | 174000600 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 1,3-dimethyl-2-(4-methylpenta-1,3-dien-2-yl)benzene |
| SMILES | C=C(C=C(C)C)c1c(C)cccc1C |
| InChI | InChI=1S/C14H18/c1-10(2)9-13(5)14-11(3)7-6-8-12(14)4/h6-9H,5H2,1-4H3 |
| InChIKey | FYZMBKIOLXNWEQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|