C13H14 — CID 145265911
2-buta-1,3-dien-2-yl-1-ethenyl-3-methylbenzene (PubChem CID 145265911) has the molecular formula C13H14 and a molecular weight of 170.25 g/mol. Its IUPAC name is 2-buta-1,3-dien-2-yl-1-ethenyl-3-methylbenzene.
| Compound Name | 2-buta-1,3-dien-2-yl-1-ethenyl-3-methylbenzene |
|---|---|
| PubChem CID | 145265911 |
| Molecular Formula | C13H14 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 2-buta-1,3-dien-2-yl-1-ethenyl-3-methylbenzene |
| SMILES | C=CC(=C)c1c(C)cccc1C=C |
| InChI | InChI=1S/C13H14/c1-5-10(3)13-11(4)8-7-9-12(13)6-2/h5-9H,1-3H2,4H3 |
| InChIKey | JWYPIUJKKPBTIX-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|