C12H12 — CID 173466216
1-buta-1,3-dien-2-yl-3-ethenylbenzene (PubChem CID 173466216) has the molecular formula C12H12 and a molecular weight of 156.23 g/mol. Its IUPAC name is 1-buta-1,3-dien-2-yl-3-ethenylbenzene.
| Compound Name | 1-buta-1,3-dien-2-yl-3-ethenylbenzene |
|---|---|
| PubChem CID | 173466216 |
| Molecular Formula | C12H12 |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 1-buta-1,3-dien-2-yl-3-ethenylbenzene |
| SMILES | C=CC(=C)c1cccc(C=C)c1 |
| InChI | InChI=1S/C12H12/c1-4-10(3)12-8-6-7-11(5-2)9-12/h4-9H,1-3H2 |
| InChIKey | UGZMBLJBKIPQSL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|