C13H16 — CID 140596687
1-buta-1,3-dien-2-yl-3-propylbenzene (PubChem CID 140596687) has the molecular formula C13H16 and a molecular weight of 172.27 g/mol. Its IUPAC name is 1-buta-1,3-dien-2-yl-3-propylbenzene.
| Compound Name | 1-buta-1,3-dien-2-yl-3-propylbenzene |
|---|---|
| PubChem CID | 140596687 |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 1-buta-1,3-dien-2-yl-3-propylbenzene |
| SMILES | C=CC(=C)c1cccc(CCC)c1 |
| InChI | InChI=1S/C13H16/c1-4-7-12-8-6-9-13(10-12)11(3)5-2/h5-6,8-10H,2-4,7H2,1H3 |
| InChIKey | WNWNBSCTIOFZIZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|