C18H20O — CID 115811990
(3,5-dimethylphenyl)-(3-propylphenyl)methanone (PubChem CID 115811990) has the molecular formula C18H20O and a molecular weight of 252.36 g/mol. Its IUPAC name is (3,5-dimethylphenyl)-(3-propylphenyl)methanone.
| Compound Name | (3,5-dimethylphenyl)-(3-propylphenyl)methanone |
|---|---|
| PubChem CID | 115811990 |
| Molecular Formula | C18H20O |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | (3,5-dimethylphenyl)-(3-propylphenyl)methanone |
| SMILES | CCCc1cccc(C(=O)c2cc(C)cc(C)c2)c1 |
| InChI | InChI=1S/C18H20O/c1-4-6-15-7-5-8-16(12-15)18(19)17-10-13(2)9-14(3)11-17/h5,7-12H,4,6H2,1-3H3 |
| InChIKey | QIINCFYTHAMSIN-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |