C13H17N — CID 155055038
3-methyl-2-(4-methylpenta-1,3-dien-3-yl)aniline (PubChem CID 155055038) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 3-methyl-2-(4-methylpenta-1,3-dien-3-yl)aniline.
| Compound Name | 3-methyl-2-(4-methylpenta-1,3-dien-3-yl)aniline |
|---|---|
| PubChem CID | 155055038 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 3-methyl-2-(4-methylpenta-1,3-dien-3-yl)aniline |
| SMILES | C=CC(=C(C)C)c1c(C)cccc1N |
| InChI | InChI=1S/C13H17N/c1-5-11(9(2)3)13-10(4)7-6-8-12(13)14/h5-8H,1,14H2,2-4H3 |
| InChIKey | PPQXVPFJKPPMBT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|