About 3-methyl-2-(4-methylpenta-1,3-dien-3-yl)aniline
3-methyl-2-(4-methylpenta-1,3-dien-3-yl)aniline (PubChem CID 155055038) has the molecular formula C13H17N
and a molecular weight of 187.29 g/mol. Its IUPAC name is 3-methyl-2-(4-methylpenta-1,3-dien-3-yl)aniline.
Molecular Properties
| Compound Name | 3-methyl-2-(4-methylpenta-1,3-dien-3-yl)aniline |
| PubChem CID | 155055038 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 3-methyl-2-(4-methylpenta-1,3-dien-3-yl)aniline |
| SMILES | C=CC(=C(C)C)c1c(C)cccc1N |
| InChI | InChI=1S/C13H17N/c1-5-11(9(2)3)13-10(4)7-6-8-12(13)14/h5-8H,1,14H2,2-4H3 |
| InChIKey | PPQXVPFJKPPMBT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-2-(4-methylpenta-1,3-dien-3-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-2-(4-methylpenta-1,3-dien-3-yl)aniline?
The IUPAC name of 3-methyl-2-(4-methylpenta-1,3-dien-3-yl)aniline (CID 155055038) is 3-methyl-2-(4-methylpenta-1,3-dien-3-yl)aniline.
What is the SMILES notation for 3-methyl-2-(4-methylpenta-1,3-dien-3-yl)aniline?
The canonical SMILES for 3-methyl-2-(4-methylpenta-1,3-dien-3-yl)aniline is C=CC(=C(C)C)c1c(C)cccc1N.
What is the InChIKey of 3-methyl-2-(4-methylpenta-1,3-dien-3-yl)aniline?
The InChIKey is PPQXVPFJKPPMBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N/c1-5-11(9(2)3)13-10(4)7-6-8-12(13)14/h5-8H,1,14H2,2-4H3.
What are the key properties of 3-methyl-2-(4-methylpenta-1,3-dien-3-yl)aniline?
3-methyl-2-(4-methylpenta-1,3-dien-3-yl)aniline has a molecular weight of 187.29 g/mol, XLogP of 3.56, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-2-(4-methylpenta-1,3-dien-3-yl)aniline is sourced from PubChem (CID 155055038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).