C13H15NO2 — CID 155327690
(2E)-2-amino-1-(2-hydroxy-6-methylphenyl)-3-methylpenta-2,4-dien-1-one (PubChem CID 155327690) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is (2E)-2-amino-1-(2-hydroxy-6-methylphenyl)-3-methylpenta-2,4-dien-1-one.
| Compound Name | (2E)-2-amino-1-(2-hydroxy-6-methylphenyl)-3-methylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 155327690 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | (2E)-2-amino-1-(2-hydroxy-6-methylphenyl)-3-methylpenta-2,4-dien-1-one |
| SMILES | C=C/C(C)=C(/N)C(=O)c1c(C)cccc1O |
| InChI | InChI=1S/C13H15NO2/c1-4-8(2)12(14)13(16)11-9(3)6-5-7-10(11)15/h4-7,15H,1,14H2,2-3H3/b12-8+ |
| InChIKey | FLCUEJBGLBBTRW-XYOKQWHBSA-N |
| XLogP | 2.30 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|