C12H17N — CID 164584980
2-(2,6-dimethylphenyl)-N-methylprop-2-en-1-amine (PubChem CID 164584980) has the molecular formula C12H17N and a molecular weight of 175.27 g/mol. Its IUPAC name is 2-(2,6-dimethylphenyl)-N-methylprop-2-en-1-amine.
| Compound Name | 2-(2,6-dimethylphenyl)-N-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 164584980 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 2-(2,6-dimethylphenyl)-N-methylprop-2-en-1-amine |
| SMILES | C=C(CNC)c1c(C)cccc1C |
| InChI | InChI=1S/C12H17N/c1-9-6-5-7-10(2)12(9)11(3)8-13-4/h5-7,13H,3,8H2,1-2,4H3 |
| InChIKey | BQYLOYWJRJFLMC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |