About 3-[(Z)-but-2-en-2-yl]-1-fluoro-2,4-dimethylbenzene
3-[(Z)-but-2-en-2-yl]-1-fluoro-2,4-dimethylbenzene (PubChem CID 170757404) has the molecular formula C12H15F
and a molecular weight of 178.25 g/mol. Its IUPAC name is 3-[(Z)-but-2-en-2-yl]-1-fluoro-2,4-dimethylbenzene.
Analyze 3-[(Z)-but-2-en-2-yl]-1-fluoro-2,4-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(Z)-but-2-en-2-yl]-1-fluoro-2,4-dimethylbenzene?
The IUPAC name of 3-[(Z)-but-2-en-2-yl]-1-fluoro-2,4-dimethylbenzene (CID 170757404) is 3-[(Z)-but-2-en-2-yl]-1-fluoro-2,4-dimethylbenzene.
What is the SMILES notation for 3-[(Z)-but-2-en-2-yl]-1-fluoro-2,4-dimethylbenzene?
The canonical SMILES for 3-[(Z)-but-2-en-2-yl]-1-fluoro-2,4-dimethylbenzene is C/C=C(/C)c1c(C)ccc(F)c1C.
What is the InChIKey of 3-[(Z)-but-2-en-2-yl]-1-fluoro-2,4-dimethylbenzene?
The InChIKey is RBAXOZCAKZEDRE-YVMONPNESA-N. The full InChI is InChI=1S/C12H15F/c1-5-8(2)12-9(3)6-7-11(13)10(12)4/h5-7H,1-4H3/b8-5-.
What are the key properties of 3-[(Z)-but-2-en-2-yl]-1-fluoro-2,4-dimethylbenzene?
3-[(Z)-but-2-en-2-yl]-1-fluoro-2,4-dimethylbenzene has a molecular weight of 178.25 g/mol, XLogP of 3.87, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(Z)-but-2-en-2-yl]-1-fluoro-2,4-dimethylbenzene is sourced from PubChem (CID 170757404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).