C10H10F2 — CID 166532604
1,4-difluoro-2-methyl-3-prop-1-en-2-ylbenzene (PubChem CID 166532604) has the molecular formula C10H10F2 and a molecular weight of 168.19 g/mol. Its IUPAC name is 1,4-difluoro-2-methyl-3-prop-1-en-2-ylbenzene.
| Compound Name | 1,4-difluoro-2-methyl-3-prop-1-en-2-ylbenzene |
|---|---|
| PubChem CID | 166532604 |
| Molecular Formula | C10H10F2 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 1,4-difluoro-2-methyl-3-prop-1-en-2-ylbenzene |
| SMILES | C=C(C)c1c(F)ccc(F)c1C |
| InChI | InChI=1S/C10H10F2/c1-6(2)10-7(3)8(11)4-5-9(10)12/h4-5H,1H2,2-3H3 |
| InChIKey | JFRLEOQZSHIELK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |