C9H7ClF2 — CID 171522333
5-chloro-1,3-difluoro-2-prop-1-en-2-ylbenzene (PubChem CID 171522333) has the molecular formula C9H7ClF2 and a molecular weight of 188.60 g/mol. Its IUPAC name is 5-chloro-1,3-difluoro-2-prop-1-en-2-ylbenzene.
| Compound Name | 5-chloro-1,3-difluoro-2-prop-1-en-2-ylbenzene |
|---|---|
| PubChem CID | 171522333 |
| Molecular Formula | C9H7ClF2 |
| Molecular Weight | 188.60 g/mol |
| Exact Mass | 188.02 |
| IUPAC Name | 5-chloro-1,3-difluoro-2-prop-1-en-2-ylbenzene |
| SMILES | C=C(C)c1c(F)cc(Cl)cc1F |
| InChI | InChI=1S/C9H7ClF2/c1-5(2)9-7(11)3-6(10)4-8(9)12/h3-4H,1H2,2H3 |
| InChIKey | KLHXGZGQCWSMSA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.60 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |