C10H9Cl2FO — CID 130067754
1-(2,4-dichloro-6-fluorophenyl)butan-1-one (PubChem CID 130067754) has the molecular formula C10H9Cl2FO and a molecular weight of 235.08 g/mol. Its IUPAC name is 1-(2,4-dichloro-6-fluorophenyl)butan-1-one.
| Compound Name | 1-(2,4-dichloro-6-fluorophenyl)butan-1-one |
|---|---|
| PubChem CID | 130067754 |
| Molecular Formula | C10H9Cl2FO |
| Molecular Weight | 235.08 g/mol |
| Exact Mass | 234.00 |
| IUPAC Name | 1-(2,4-dichloro-6-fluorophenyl)butan-1-one |
| SMILES | CCCC(=O)c1c(F)cc(Cl)cc1Cl |
| InChI | InChI=1S/C10H9Cl2FO/c1-2-3-9(14)10-7(12)4-6(11)5-8(10)13/h4-5H,2-3H2,1H3 |
| InChIKey | VCBFTJWAFMMGLV-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.08 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |