C8H6Cl3NO — CID 70444583
2-amino-1-(2,4,6-trichlorophenyl)ethanone (PubChem CID 70444583) has the molecular formula C8H6Cl3NO and a molecular weight of 238.50 g/mol. Its IUPAC name is 2-amino-1-(2,4,6-trichlorophenyl)ethanone.
| Compound Name | 2-amino-1-(2,4,6-trichlorophenyl)ethanone |
|---|---|
| PubChem CID | 70444583 |
| Molecular Formula | C8H6Cl3NO |
| Molecular Weight | 238.50 g/mol |
| Exact Mass | 236.95 |
| IUPAC Name | 2-amino-1-(2,4,6-trichlorophenyl)ethanone |
| SMILES | NCC(=O)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C8H6Cl3NO/c9-4-1-5(10)8(6(11)2-4)7(13)3-12/h1-2H,3,12H2 |
| InChIKey | XHYOSFBUKHFEES-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.50 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |