C13H9Cl3N2O — CID 58138650
2-(6-amino-2-pyridinyl)-1-(2,4,6-trichlorophenyl)ethanone (PubChem CID 58138650) has the molecular formula C13H9Cl3N2O and a molecular weight of 315.59 g/mol. Its IUPAC name is 2-(6-amino-2-pyridinyl)-1-(2,4,6-trichlorophenyl)ethanone.
| Compound Name | 2-(6-amino-2-pyridinyl)-1-(2,4,6-trichlorophenyl)ethanone |
|---|---|
| PubChem CID | 58138650 |
| Molecular Formula | C13H9Cl3N2O |
| Molecular Weight | 315.59 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | 2-(6-amino-2-pyridinyl)-1-(2,4,6-trichlorophenyl)ethanone |
| SMILES | Nc1cccc(CC(=O)c2c(Cl)cc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C13H9Cl3N2O/c14-7-4-9(15)13(10(16)5-7)11(19)6-8-2-1-3-12(17)18-8/h1-5H,6H2,(H2,17,18) |
| InChIKey | LIKRCNNASWRXFM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.59 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |