C13H13Cl3O3 — CID 105349519
3,3-dimethyl-5-oxo-5-(2,4,6-trichlorophenyl)pentanoic acid (PubChem CID 105349519) has the molecular formula C13H13Cl3O3 and a molecular weight of 323.60 g/mol. Its IUPAC name is 3,3-dimethyl-5-oxo-5-(2,4,6-trichlorophenyl)pentanoic acid.
| Compound Name | 3,3-dimethyl-5-oxo-5-(2,4,6-trichlorophenyl)pentanoic acid |
|---|---|
| PubChem CID | 105349519 |
| Molecular Formula | C13H13Cl3O3 |
| Molecular Weight | 323.60 g/mol |
| Exact Mass | 321.99 |
| IUPAC Name | 3,3-dimethyl-5-oxo-5-(2,4,6-trichlorophenyl)pentanoic acid |
| SMILES | CC(C)(CC(=O)O)CC(=O)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C13H13Cl3O3/c1-13(2,6-11(18)19)5-10(17)12-8(15)3-7(14)4-9(12)16/h3-4H,5-6H2,1-2H3,(H,18,19) |
| InChIKey | CTDUBMZFSSAZQL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.60 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |