C15H20O3 — CID 146004431
5-(2-ethylphenyl)-3,3-dimethyl-5-oxopentanoic acid (PubChem CID 146004431) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is 5-(2-ethylphenyl)-3,3-dimethyl-5-oxopentanoic acid.
| Compound Name | 5-(2-ethylphenyl)-3,3-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 146004431 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 5-(2-ethylphenyl)-3,3-dimethyl-5-oxopentanoic acid |
| SMILES | CCc1ccccc1C(=O)CC(C)(C)CC(=O)O |
| InChI | InChI=1S/C15H20O3/c1-4-11-7-5-6-8-12(11)13(16)9-15(2,3)10-14(17)18/h5-8H,4,9-10H2,1-3H3,(H,17,18) |
| InChIKey | XDRDYANXKDMRDD-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |