C15H17NO3 — CID 55156722
5-(1H-indol-3-yl)-3,3-dimethyl-5-oxopentanoic acid (PubChem CID 55156722) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 5-(1H-indol-3-yl)-3,3-dimethyl-5-oxopentanoic acid.
| Compound Name | 5-(1H-indol-3-yl)-3,3-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 55156722 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 5-(1H-indol-3-yl)-3,3-dimethyl-5-oxopentanoic acid |
| SMILES | CC(C)(CC(=O)O)CC(=O)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C15H17NO3/c1-15(2,8-14(18)19)7-13(17)11-9-16-12-6-4-3-5-10(11)12/h3-6,9,16H,7-8H2,1-2H3,(H,18,19) |
| InChIKey | SURXKSNMOKSWBB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 70.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |