C9H9F2NS — CID 163623914
3,6-difluoro-N,2-dimethylbenzenecarbothioamide (PubChem CID 163623914) has the molecular formula C9H9F2NS and a molecular weight of 201.24 g/mol. Its IUPAC name is 3,6-difluoro-N,2-dimethylbenzenecarbothioamide.
| Compound Name | 3,6-difluoro-N,2-dimethylbenzenecarbothioamide |
|---|---|
| PubChem CID | 163623914 |
| Molecular Formula | C9H9F2NS |
| Molecular Weight | 201.24 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 3,6-difluoro-N,2-dimethylbenzenecarbothioamide |
| SMILES | CNC(=S)c1c(F)ccc(F)c1C |
| InChI | InChI=1S/C9H9F2NS/c1-5-6(10)3-4-7(11)8(5)9(13)12-2/h3-4H,1-2H3,(H,12,13) |
| InChIKey | HQMCJWUJPHUWMT-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.24 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|