C9H10FNS — CID 116827662
4-fluoro-N,3-dimethylbenzenecarbothioamide (PubChem CID 116827662) has the molecular formula C9H10FNS and a molecular weight of 183.25 g/mol. Its IUPAC name is 4-fluoro-N,3-dimethylbenzenecarbothioamide.
| Compound Name | 4-fluoro-N,3-dimethylbenzenecarbothioamide |
|---|---|
| PubChem CID | 116827662 |
| Molecular Formula | C9H10FNS |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 4-fluoro-N,3-dimethylbenzenecarbothioamide |
| SMILES | CNC(=S)c1ccc(F)c(C)c1 |
| InChI | InChI=1S/C9H10FNS/c1-6-5-7(9(12)11-2)3-4-8(6)10/h3-5H,1-2H3,(H,11,12) |
| InChIKey | KUJOVRQMEPNZLG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|