C7H6F2N2S — CID 91618835
3,4-difluorobenzenecarbothiohydrazide (PubChem CID 91618835) has the molecular formula C7H6F2N2S and a molecular weight of 188.20 g/mol. Its IUPAC name is 3,4-difluorobenzenecarbothiohydrazide.
| Compound Name | 3,4-difluorobenzenecarbothiohydrazide |
|---|---|
| PubChem CID | 91618835 |
| Molecular Formula | C7H6F2N2S |
| Molecular Weight | 188.20 g/mol |
| Exact Mass | 188.02 |
| IUPAC Name | 3,4-difluorobenzenecarbothiohydrazide |
| SMILES | NNC(=S)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C7H6F2N2S/c8-5-2-1-4(3-6(5)9)7(12)11-10/h1-3H,10H2,(H,11,12) |
| InChIKey | QBGXEBLDHFNIIS-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.20 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|