C8H6F2OS — CID 19768553
O-methyl 3,4-difluorobenzenecarbothioate (PubChem CID 19768553) has the molecular formula C8H6F2OS and a molecular weight of 188.20 g/mol. Its IUPAC name is O-methyl 3,4-difluorobenzenecarbothioate.
| Compound Name | O-methyl 3,4-difluorobenzenecarbothioate |
|---|---|
| PubChem CID | 19768553 |
| Molecular Formula | C8H6F2OS |
| Molecular Weight | 188.20 g/mol |
| Exact Mass | 188.01 |
| IUPAC Name | O-methyl 3,4-difluorobenzenecarbothioate |
| SMILES | COC(=S)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C8H6F2OS/c1-11-8(12)5-2-3-6(9)7(10)4-5/h2-4H,1H3 |
| InChIKey | INZTZBDEIQODKK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.20 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|