C9H12FN — CID 155403467
4-fluoro-N,2,3-trimethylaniline (PubChem CID 155403467) has the molecular formula C9H12FN and a molecular weight of 153.20 g/mol. Its IUPAC name is 4-fluoro-N,2,3-trimethylaniline.
| Compound Name | 4-fluoro-N,2,3-trimethylaniline |
|---|---|
| PubChem CID | 155403467 |
| Molecular Formula | C9H12FN |
| Molecular Weight | 153.20 g/mol |
| Exact Mass | 153.10 |
| IUPAC Name | 4-fluoro-N,2,3-trimethylaniline |
| SMILES | CNc1ccc(F)c(C)c1C |
| InChI | InChI=1S/C9H12FN/c1-6-7(2)9(11-3)5-4-8(6)10/h4-5,11H,1-3H3 |
| InChIKey | PCONSGUVOWHLAR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.20 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |