C13H24FN2OS+ — CID 177032095
ethane;(4-fluoro-2,3-dimethylanilino)-hydroxy-propyl-sulfanylazanium (PubChem CID 177032095) has the molecular formula C13H24FN2OS+ and a molecular weight of 275.41 g/mol. Its IUPAC name is ethane;(4-fluoro-2,3-dimethylanilino)-hydroxy-propyl-sulfanylazanium.
| Compound Name | ethane;(4-fluoro-2,3-dimethylanilino)-hydroxy-propyl-sulfanylazanium |
|---|---|
| PubChem CID | 177032095 |
| Molecular Formula | C13H24FN2OS+ |
| Molecular Weight | 275.41 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | ethane;(4-fluoro-2,3-dimethylanilino)-hydroxy-propyl-sulfanylazanium |
| SMILES | CC.CCC[N+](O)(S)Nc1ccc(F)c(C)c1C |
| InChI | InChI=1S/C11H18FN2OS.C2H6/c1-4-7-14(15,16)13-11-6-5-10(12)8(2)9(11)3;1-2/h5-6,13,15-16H,4,7H2,1-3H3;1-2H3/q+1; |
| InChIKey | ZJGJIDFFXQTKDT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|