C10H15F2NOS — CID 163229300
N-(2,4-difluoro-3-methylphenyl)methanesulfinamide;ethane (PubChem CID 163229300) has the molecular formula C10H15F2NOS and a molecular weight of 235.30 g/mol. Its IUPAC name is N-(2,4-difluoro-3-methylphenyl)methanesulfinamide;ethane.
| Compound Name | N-(2,4-difluoro-3-methylphenyl)methanesulfinamide;ethane |
|---|---|
| PubChem CID | 163229300 |
| Molecular Formula | C10H15F2NOS |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | N-(2,4-difluoro-3-methylphenyl)methanesulfinamide;ethane |
| SMILES | CC.Cc1c(F)ccc(NS(C)=O)c1F |
| InChI | InChI=1S/C8H9F2NOS.C2H6/c1-5-6(9)3-4-7(8(5)10)11-13(2)12;1-2/h3-4,11H,1-2H3;1-2H3 |
| InChIKey | DPJQQBPRJRVVQQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |