C16H18F3NS — CID 156833126
2,4-difluoro-N-(3-fluoro-4-methylphenyl)sulfanyl-3-methylaniline;ethane (PubChem CID 156833126) has the molecular formula C16H18F3NS and a molecular weight of 313.39 g/mol. Its IUPAC name is 2,4-difluoro-N-(3-fluoro-4-methylphenyl)sulfanyl-3-methylaniline;ethane.
| Compound Name | 2,4-difluoro-N-(3-fluoro-4-methylphenyl)sulfanyl-3-methylaniline;ethane |
|---|---|
| PubChem CID | 156833126 |
| Molecular Formula | C16H18F3NS |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | 2,4-difluoro-N-(3-fluoro-4-methylphenyl)sulfanyl-3-methylaniline;ethane |
| SMILES | CC.Cc1ccc(SNc2ccc(F)c(C)c2F)cc1F |
| InChI | InChI=1S/C14H12F3NS.C2H6/c1-8-3-4-10(7-12(8)16)19-18-13-6-5-11(15)9(2)14(13)17;1-2/h3-7,18H,1-2H3;1-2H3 |
| InChIKey | VNGNCWNRFBTLAQ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|