C14H11Cl2F2NOS — CID 156833206
[2,5-dichloro-3-(2,4-difluoro-3-methylanilino)sulfanylphenyl]methanol (PubChem CID 156833206) has the molecular formula C14H11Cl2F2NOS and a molecular weight of 350.22 g/mol. Its IUPAC name is [2,5-dichloro-3-(2,4-difluoro-3-methylanilino)sulfanylphenyl]methanol.
| Compound Name | [2,5-dichloro-3-(2,4-difluoro-3-methylanilino)sulfanylphenyl]methanol |
|---|---|
| PubChem CID | 156833206 |
| Molecular Formula | C14H11Cl2F2NOS |
| Molecular Weight | 350.22 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | [2,5-dichloro-3-(2,4-difluoro-3-methylanilino)sulfanylphenyl]methanol |
| SMILES | Cc1c(F)ccc(NSc2cc(Cl)cc(CO)c2Cl)c1F |
| InChI | InChI=1S/C14H11Cl2F2NOS/c1-7-10(17)2-3-11(14(7)18)19-21-12-5-9(15)4-8(6-20)13(12)16/h2-5,19-20H,6H2,1H3 |
| InChIKey | JTIVNHFQZQZFMI-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.22 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|