C12H6BrCl2F2NS — CID 156833236
3-bromo-N-(2,5-dichlorophenyl)sulfanyl-2,4-difluoroaniline (PubChem CID 156833236) has the molecular formula C12H6BrCl2F2NS and a molecular weight of 385.06 g/mol. Its IUPAC name is 3-bromo-N-(2,5-dichlorophenyl)sulfanyl-2,4-difluoroaniline.
| Compound Name | 3-bromo-N-(2,5-dichlorophenyl)sulfanyl-2,4-difluoroaniline |
|---|---|
| PubChem CID | 156833236 |
| Molecular Formula | C12H6BrCl2F2NS |
| Molecular Weight | 385.06 g/mol |
| Exact Mass | 382.87 |
| IUPAC Name | 3-bromo-N-(2,5-dichlorophenyl)sulfanyl-2,4-difluoroaniline |
| SMILES | Fc1ccc(NSc2cc(Cl)ccc2Cl)c(F)c1Br |
| InChI | InChI=1S/C12H6BrCl2F2NS/c13-11-8(16)3-4-9(12(11)17)18-19-10-5-6(14)1-2-7(10)15/h1-5,18H |
| InChIKey | RLLZDMIVOXANIR-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.06 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|