C20H12Cl2F2N4S — CID 156833178
6-[3-[(2,5-dichlorophenyl)sulfanylamino]-2,6-difluorophenyl]quinazolin-2-amine (PubChem CID 156833178) has the molecular formula C20H12Cl2F2N4S and a molecular weight of 449.31 g/mol. Its IUPAC name is 6-[3-[(2,5-dichlorophenyl)sulfanylamino]-2,6-difluorophenyl]quinazolin-2-amine.
| Compound Name | 6-[3-[(2,5-dichlorophenyl)sulfanylamino]-2,6-difluorophenyl]quinazolin-2-amine |
|---|---|
| PubChem CID | 156833178 |
| Molecular Formula | C20H12Cl2F2N4S |
| Molecular Weight | 449.31 g/mol |
| Exact Mass | 448.01 |
| IUPAC Name | 6-[3-[(2,5-dichlorophenyl)sulfanylamino]-2,6-difluorophenyl]quinazolin-2-amine |
| SMILES | Nc1ncc2cc(-c3c(F)ccc(NSc4cc(Cl)ccc4Cl)c3F)ccc2n1 |
| InChI | InChI=1S/C20H12Cl2F2N4S/c21-12-2-3-13(22)17(8-12)29-28-16-6-4-14(23)18(19(16)24)10-1-5-15-11(7-10)9-26-20(25)27-15/h1-9,28H,(H2,25,26,27) |
| InChIKey | PSTLBXWMHBEMGV-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.31 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|