C21H15ClF2N4OS — CID 156833388
7-[3-[(5-chloro-2-methoxy-3-pyridinyl)sulfanylamino]-2,6-difluorophenyl]isoquinolin-3-amine (PubChem CID 156833388) has the molecular formula C21H15ClF2N4OS and a molecular weight of 444.89 g/mol. Its IUPAC name is 7-[3-[(5-chloro-2-methoxy-3-pyridinyl)sulfanylamino]-2,6-difluorophenyl]isoquinolin-3-amine.
| Compound Name | 7-[3-[(5-chloro-2-methoxy-3-pyridinyl)sulfanylamino]-2,6-difluorophenyl]isoquinolin-3-amine |
|---|---|
| PubChem CID | 156833388 |
| Molecular Formula | C21H15ClF2N4OS |
| Molecular Weight | 444.89 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | 7-[3-[(5-chloro-2-methoxy-3-pyridinyl)sulfanylamino]-2,6-difluorophenyl]isoquinolin-3-amine |
| SMILES | COc1ncc(Cl)cc1SNc1ccc(F)c(-c2ccc3cc(N)ncc3c2)c1F |
| InChI | InChI=1S/C21H15ClF2N4OS/c1-29-21-17(8-14(22)10-27-21)30-28-16-5-4-15(23)19(20(16)24)12-3-2-11-7-18(25)26-9-13(11)6-12/h2-10,28H,1H3,(H2,25,26) |
| InChIKey | AXJHFMXSXNVBGZ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.89 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|