C26H23ClF3N5OS — CID 164593738
N-[(5-chloro-2-methoxy-3-pyridinyl)sulfanyl]-2,4-difluoro-3-[5-fluoro-1-[C-methyl-N-[(Z)-pent-1-enyl]carbonimidoyl]imidazo[1,5-a]pyridin-6-yl]aniline (PubChem CID 164593738) has the molecular formula C26H23ClF3N5OS and a molecular weight of 546.02 g/mol. Its IUPAC name is N-[(5-chloro-2-methoxy-3-pyridinyl)sulfanyl]-2,4-difluoro-3-[5-fluoro-1-[C-methyl-N-[(Z)-pent-1-enyl]carbonimidoyl]imidazo[1,5-a]pyridin-6-yl]aniline.
| Compound Name | N-[(5-chloro-2-methoxy-3-pyridinyl)sulfanyl]-2,4-difluoro-3-[5-fluoro-1-[C-methyl-N-[(Z)-pent-1-enyl]carbonimidoyl]imidazo[1,5-a]pyridin-6-yl]aniline |
|---|---|
| PubChem CID | 164593738 |
| Molecular Formula | C26H23ClF3N5OS |
| Molecular Weight | 546.02 g/mol |
| Exact Mass | 545.13 |
| IUPAC Name | N-[(5-chloro-2-methoxy-3-pyridinyl)sulfanyl]-2,4-difluoro-3-[5-fluoro-1-[C-methyl-N-[(Z)-pent-1-enyl]carbonimidoyl]imidazo[1,5-a]pyridin-6-yl]aniline |
| SMILES | CCC/C=C\N=C(/C)c1ncn2c(F)c(-c3c(F)ccc(NSc4cc(Cl)cnc4OC)c3F)ccc12 |
| InChI | InChI=1S/C26H23ClF3N5OS/c1-4-5-6-11-31-15(2)24-20-10-7-17(25(30)35(20)14-33-24)22-18(28)8-9-19(23(22)29)34-37-21-12-16(27)13-32-26(21)36-3/h6-14,34H,4-5H2,1-3H3/b11-6-,31-15+ |
| InChIKey | ZHPONKPTRHLCGQ-VVSBRKJRSA-N |
| XLogP | 7.72 |
| TPSA | 63.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.02 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|