C26H24ClF2N5OS — CID 169156170
6-[3-[(5-chloro-2-methoxy-3-pyridinyl)sulfanylamino]-2,6-difluorophenyl]-N-cyclohexylquinazolin-2-amine (PubChem CID 169156170) has the molecular formula C26H24ClF2N5OS and a molecular weight of 528.03 g/mol. Its IUPAC name is 6-[3-[(5-chloro-2-methoxy-3-pyridinyl)sulfanylamino]-2,6-difluorophenyl]-N-cyclohexylquinazolin-2-amine.
| Compound Name | 6-[3-[(5-chloro-2-methoxy-3-pyridinyl)sulfanylamino]-2,6-difluorophenyl]-N-cyclohexylquinazolin-2-amine |
|---|---|
| PubChem CID | 169156170 |
| Molecular Formula | C26H24ClF2N5OS |
| Molecular Weight | 528.03 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | 6-[3-[(5-chloro-2-methoxy-3-pyridinyl)sulfanylamino]-2,6-difluorophenyl]-N-cyclohexylquinazolin-2-amine |
| SMILES | COc1ncc(Cl)cc1SNc1ccc(F)c(-c2ccc3nc(NC4CCCCC4)ncc3c2)c1F |
| InChI | InChI=1S/C26H24ClF2N5OS/c1-35-25-22(12-17(27)14-30-25)36-34-21-10-8-19(28)23(24(21)29)15-7-9-20-16(11-15)13-31-26(33-20)32-18-5-3-2-4-6-18/h7-14,18,34H,2-6H2,1H3,(H,31,32,33) |
| InChIKey | PDORZLVFUJZCOC-UHFFFAOYSA-N |
| XLogP | 7.50 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.03 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|