C27H28ClN5OS — CID 142488891
6-[6-[(2-chlorophenyl)sulfanylamino]-2-methoxy-3-pyridinyl]-N-cyclohexyl-7-methylquinazolin-2-amine (PubChem CID 142488891) has the molecular formula C27H28ClN5OS and a molecular weight of 506.08 g/mol. Its IUPAC name is 6-[6-[(2-chlorophenyl)sulfanylamino]-2-methoxy-3-pyridinyl]-N-cyclohexyl-7-methylquinazolin-2-amine.
| Compound Name | 6-[6-[(2-chlorophenyl)sulfanylamino]-2-methoxy-3-pyridinyl]-N-cyclohexyl-7-methylquinazolin-2-amine |
|---|---|
| PubChem CID | 142488891 |
| Molecular Formula | C27H28ClN5OS |
| Molecular Weight | 506.08 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | 6-[6-[(2-chlorophenyl)sulfanylamino]-2-methoxy-3-pyridinyl]-N-cyclohexyl-7-methylquinazolin-2-amine |
| SMILES | COc1nc(NSc2ccccc2Cl)ccc1-c1cc2cnc(NC3CCCCC3)nc2cc1C |
| InChI | InChI=1S/C27H28ClN5OS/c1-17-14-23-18(16-29-27(31-23)30-19-8-4-3-5-9-19)15-21(17)20-12-13-25(32-26(20)34-2)33-35-24-11-7-6-10-22(24)28/h6-7,10-16,19H,3-5,8-9H2,1-2H3,(H,32,33)(H,29,30,31) |
| InChIKey | QFODLBXAFZWTGV-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.08 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|