C28H36ClN7S — CID 142590405
6-[3-[(2-chlorophenyl)sulfanylamino]-1-methylpyrazol-5-yl]-N-cyclohexyl-8-propan-2-ylquinazolin-2-amine;methanamine (PubChem CID 142590405) has the molecular formula C28H36ClN7S and a molecular weight of 538.17 g/mol. Its IUPAC name is 6-[3-[(2-chlorophenyl)sulfanylamino]-1-methylpyrazol-5-yl]-N-cyclohexyl-8-propan-2-ylquinazolin-2-amine;methanamine.
| Compound Name | 6-[3-[(2-chlorophenyl)sulfanylamino]-1-methylpyrazol-5-yl]-N-cyclohexyl-8-propan-2-ylquinazolin-2-amine;methanamine |
|---|---|
| PubChem CID | 142590405 |
| Molecular Formula | C28H36ClN7S |
| Molecular Weight | 538.17 g/mol |
| Exact Mass | 537.24 |
| IUPAC Name | 6-[3-[(2-chlorophenyl)sulfanylamino]-1-methylpyrazol-5-yl]-N-cyclohexyl-8-propan-2-ylquinazolin-2-amine;methanamine |
| SMILES | CC(C)c1cc(-c2cc(NSc3ccccc3Cl)nn2C)cc2cnc(NC3CCCCC3)nc12.CN |
| InChI | InChI=1S/C27H31ClN6S.CH5N/c1-17(2)21-14-18(13-19-16-29-27(31-26(19)21)30-20-9-5-4-6-10-20)23-15-25(32-34(23)3)33-35-24-12-8-7-11-22(24)28;1-2/h7-8,11-17,20H,4-6,9-10H2,1-3H3,(H,32,33)(H,29,30,31);2H2,1H3 |
| InChIKey | XKRHVDZIGXYERS-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 93.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.17 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|