C30H35ClFN5S — CID 142488948
6-[4-[(2-chlorophenyl)sulfanylamino]-3-fluorophenyl]-N-cyclohexyl-8-ethylquinazolin-2-amine;N-methylmethanamine (PubChem CID 142488948) has the molecular formula C30H35ClFN5S and a molecular weight of 552.16 g/mol. Its IUPAC name is 6-[4-[(2-chlorophenyl)sulfanylamino]-3-fluorophenyl]-N-cyclohexyl-8-ethylquinazolin-2-amine;N-methylmethanamine.
| Compound Name | 6-[4-[(2-chlorophenyl)sulfanylamino]-3-fluorophenyl]-N-cyclohexyl-8-ethylquinazolin-2-amine;N-methylmethanamine |
|---|---|
| PubChem CID | 142488948 |
| Molecular Formula | C30H35ClFN5S |
| Molecular Weight | 552.16 g/mol |
| Exact Mass | 551.23 |
| IUPAC Name | 6-[4-[(2-chlorophenyl)sulfanylamino]-3-fluorophenyl]-N-cyclohexyl-8-ethylquinazolin-2-amine;N-methylmethanamine |
| SMILES | CCc1cc(-c2ccc(NSc3ccccc3Cl)c(F)c2)cc2cnc(NC3CCCCC3)nc12.CNC |
| InChI | InChI=1S/C28H28ClFN4S.C2H7N/c1-2-18-14-20(15-21-17-31-28(33-27(18)21)32-22-8-4-3-5-9-22)19-12-13-25(24(30)16-19)34-35-26-11-7-6-10-23(26)29;1-3-2/h6-7,10-17,22,34H,2-5,8-9H2,1H3,(H,31,32,33);3H,1-2H3 |
| InChIKey | GSAOVCNSRNDAHT-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.16 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|