C32H37ClFN5S — CID 142590442
6-[4-[(2-chlorophenyl)sulfanylamino]-3-fluorophenyl]-N-cyclohexyl-8-ethylquinazolin-2-amine;pyrrolidine (PubChem CID 142590442) has the molecular formula C32H37ClFN5S and a molecular weight of 578.20 g/mol. Its IUPAC name is 6-[4-[(2-chlorophenyl)sulfanylamino]-3-fluorophenyl]-N-cyclohexyl-8-ethylquinazolin-2-amine;pyrrolidine.
| Compound Name | 6-[4-[(2-chlorophenyl)sulfanylamino]-3-fluorophenyl]-N-cyclohexyl-8-ethylquinazolin-2-amine;pyrrolidine |
|---|---|
| PubChem CID | 142590442 |
| Molecular Formula | C32H37ClFN5S |
| Molecular Weight | 578.20 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | 6-[4-[(2-chlorophenyl)sulfanylamino]-3-fluorophenyl]-N-cyclohexyl-8-ethylquinazolin-2-amine;pyrrolidine |
| SMILES | C1CCNC1.CCc1cc(-c2ccc(NSc3ccccc3Cl)c(F)c2)cc2cnc(NC3CCCCC3)nc12 |
| InChI | InChI=1S/C28H28ClFN4S.C4H9N/c1-2-18-14-20(15-21-17-31-28(33-27(18)21)32-22-8-4-3-5-9-22)19-12-13-25(24(30)16-19)34-35-26-11-7-6-10-23(26)29;1-2-4-5-3-1/h6-7,10-17,22,34H,2-5,8-9H2,1H3,(H,31,32,33);5H,1-4H2 |
| InChIKey | XWCKYRHQDIAIPL-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.20 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|