C26H34F4N6S — CID 154687047
N-cyclohexyl-8-ethyl-6-[3-fluoro-4-(3,3,3-trifluoropropylsulfanylamino)phenyl]pyrido[3,2-d]pyrimidin-2-amine;N-methylmethanamine (PubChem CID 154687047) has the molecular formula C26H34F4N6S and a molecular weight of 538.66 g/mol. Its IUPAC name is N-cyclohexyl-8-ethyl-6-[3-fluoro-4-(3,3,3-trifluoropropylsulfanylamino)phenyl]pyrido[3,2-d]pyrimidin-2-amine;N-methylmethanamine.
| Compound Name | N-cyclohexyl-8-ethyl-6-[3-fluoro-4-(3,3,3-trifluoropropylsulfanylamino)phenyl]pyrido[3,2-d]pyrimidin-2-amine;N-methylmethanamine |
|---|---|
| PubChem CID | 154687047 |
| Molecular Formula | C26H34F4N6S |
| Molecular Weight | 538.66 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | N-cyclohexyl-8-ethyl-6-[3-fluoro-4-(3,3,3-trifluoropropylsulfanylamino)phenyl]pyrido[3,2-d]pyrimidin-2-amine;N-methylmethanamine |
| SMILES | CCc1cc(-c2ccc(NSCCC(F)(F)F)c(F)c2)nc2cnc(NC3CCCCC3)nc12.CNC |
| InChI | InChI=1S/C24H27F4N5S.C2H7N/c1-2-15-13-20(16-8-9-19(18(25)12-16)33-34-11-10-24(26,27)28)31-21-14-29-23(32-22(15)21)30-17-6-4-3-5-7-17;1-3-2/h8-9,12-14,17,33H,2-7,10-11H2,1H3,(H,29,30,32);3H,1-2H3 |
| InChIKey | NCPARUSROWCGEX-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.66 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|