C28H33F5N6O4S — CID 154687021
tert-butyl (3S,5S)-3-[[8-ethyl-6-[3-fluoro-4-(3,3,3-trifluoropropylsulfonylamino)phenyl]pyrido[3,2-d]pyrimidin-2-yl]amino]-5-fluoropiperidine-1-carboxylate (PubChem CID 154687021) has the molecular formula C28H33F5N6O4S and a molecular weight of 644.67 g/mol. Its IUPAC name is tert-butyl (3S,5S)-3-[[8-ethyl-6-[3-fluoro-4-(3,3,3-trifluoropropylsulfonylamino)phenyl]pyrido[3,2-d]pyrimidin-2-yl]amino]-5-fluoropiperidine-1-carboxylate.
| Compound Name | tert-butyl (3S,5S)-3-[[8-ethyl-6-[3-fluoro-4-(3,3,3-trifluoropropylsulfonylamino)phenyl]pyrido[3,2-d]pyrimidin-2-yl]amino]-5-fluoropiperidine-1-carboxylate |
|---|---|
| PubChem CID | 154687021 |
| Molecular Formula | C28H33F5N6O4S |
| Molecular Weight | 644.67 g/mol |
| Exact Mass | 644.22 |
| IUPAC Name | tert-butyl (3S,5S)-3-[[8-ethyl-6-[3-fluoro-4-(3,3,3-trifluoropropylsulfonylamino)phenyl]pyrido[3,2-d]pyrimidin-2-yl]amino]-5-fluoropiperidine-1-carboxylate |
| SMILES | CCc1cc(-c2ccc(NS(=O)(=O)CCC(F)(F)F)c(F)c2)nc2cnc(N[C@H]3C[C@H](F)CN(C(=O)OC(C)(C)C)C3)nc12 |
| InChI | InChI=1S/C28H33F5N6O4S/c1-5-16-11-22(17-6-7-21(20(30)10-17)38-44(41,42)9-8-28(31,32)33)36-23-13-34-25(37-24(16)23)35-19-12-18(29)14-39(15-19)26(40)43-27(2,3)4/h6-7,10-11,13,18-19,38H,5,8-9,12,14-15H2,1-4H3,(H,34,35,37)/t18-,19-/m0/s1 |
| InChIKey | DHWGKKJGBKSJPF-OALUTQOASA-N |
| XLogP | 5.85 |
| TPSA | 126.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.67 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |