C26H33FN6O2 — CID 154687053
tert-butyl N-[4-[[6-(4-amino-3-fluorophenyl)-8-ethylpyrido[3,2-d]pyrimidin-2-yl]amino]cyclohexyl]carbamate (PubChem CID 154687053) has the molecular formula C26H33FN6O2 and a molecular weight of 480.59 g/mol. Its IUPAC name is tert-butyl N-[4-[[6-(4-amino-3-fluorophenyl)-8-ethylpyrido[3,2-d]pyrimidin-2-yl]amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[6-(4-amino-3-fluorophenyl)-8-ethylpyrido[3,2-d]pyrimidin-2-yl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 154687053 |
| Molecular Formula | C26H33FN6O2 |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | tert-butyl N-[4-[[6-(4-amino-3-fluorophenyl)-8-ethylpyrido[3,2-d]pyrimidin-2-yl]amino]cyclohexyl]carbamate |
| SMILES | CCc1cc(-c2ccc(N)c(F)c2)nc2cnc(NC3CCC(NC(=O)OC(C)(C)C)CC3)nc12 |
| InChI | InChI=1S/C26H33FN6O2/c1-5-15-13-21(16-6-11-20(28)19(27)12-16)32-22-14-29-24(33-23(15)22)30-17-7-9-18(10-8-17)31-25(34)35-26(2,3)4/h6,11-14,17-18H,5,7-10,28H2,1-4H3,(H,31,34)(H,29,30,33) |
| InChIKey | ZIZHUIKHXFLJBK-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|