C25H31FN6O3 — CID 154686956
tert-butyl N-[4-[[6-(4-amino-3-fluorophenyl)-8-methoxypyrido[3,2-d]pyrimidin-2-yl]amino]cyclohexyl]carbamate (PubChem CID 154686956) has the molecular formula C25H31FN6O3 and a molecular weight of 482.56 g/mol. Its IUPAC name is tert-butyl N-[4-[[6-(4-amino-3-fluorophenyl)-8-methoxypyrido[3,2-d]pyrimidin-2-yl]amino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[6-(4-amino-3-fluorophenyl)-8-methoxypyrido[3,2-d]pyrimidin-2-yl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 154686956 |
| Molecular Formula | C25H31FN6O3 |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | tert-butyl N-[4-[[6-(4-amino-3-fluorophenyl)-8-methoxypyrido[3,2-d]pyrimidin-2-yl]amino]cyclohexyl]carbamate |
| SMILES | COc1cc(-c2ccc(N)c(F)c2)nc2cnc(NC3CCC(NC(=O)OC(C)(C)C)CC3)nc12 |
| InChI | InChI=1S/C25H31FN6O3/c1-25(2,3)35-24(33)30-16-8-6-15(7-9-16)29-23-28-13-20-22(32-23)21(34-4)12-19(31-20)14-5-10-18(27)17(26)11-14/h5,10-13,15-16H,6-9,27H2,1-4H3,(H,30,33)(H,28,29,32) |
| InChIKey | UAAYBCOIGOAZJD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 124.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|