C20H13ClF2N4OS — CID 142590386
N-(2-chlorophenyl)sulfanyl-3-fluoro-5-(2-fluoroquinazolin-6-yl)-6-methoxypyridin-2-amine (PubChem CID 142590386) has the molecular formula C20H13ClF2N4OS and a molecular weight of 430.87 g/mol. Its IUPAC name is N-(2-chlorophenyl)sulfanyl-3-fluoro-5-(2-fluoroquinazolin-6-yl)-6-methoxypyridin-2-amine.
| Compound Name | N-(2-chlorophenyl)sulfanyl-3-fluoro-5-(2-fluoroquinazolin-6-yl)-6-methoxypyridin-2-amine |
|---|---|
| PubChem CID | 142590386 |
| Molecular Formula | C20H13ClF2N4OS |
| Molecular Weight | 430.87 g/mol |
| Exact Mass | 430.05 |
| IUPAC Name | N-(2-chlorophenyl)sulfanyl-3-fluoro-5-(2-fluoroquinazolin-6-yl)-6-methoxypyridin-2-amine |
| SMILES | COc1nc(NSc2ccccc2Cl)c(F)cc1-c1ccc2nc(F)ncc2c1 |
| InChI | InChI=1S/C20H13ClF2N4OS/c1-28-19-13(11-6-7-16-12(8-11)10-24-20(23)25-16)9-15(22)18(26-19)27-29-17-5-3-2-4-14(17)21/h2-10H,1H3,(H,26,27) |
| InChIKey | LKKPXIJCNFUKDO-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.87 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|